C19H18BrClN6O3 — CID 155883551
7-bromo-3-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 155883551) has the molecular formula C19H18BrClN6O3 and a molecular weight of 493.75 g/mol. Its IUPAC name is 7-bromo-3-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 7-bromo-3-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 155883551 |
| Molecular Formula | C19H18BrClN6O3 |
| Molecular Weight | 493.75 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 7-bromo-3-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1nc(Br)n2c1C(=O)N(Cc1nc([C@@H]3CO[C@@H](c4ccc(Cl)cc4)C3)no1)CN2 |
| InChI | InChI=1S/C19H18BrClN6O3/c1-10-16-18(28)26(9-22-27(16)19(20)23-10)7-15-24-17(25-30-15)12-6-14(29-8-12)11-2-4-13(21)5-3-11/h2-5,12,14,22H,6-9H2,1H3/t12-,14+/m0/s1 |
| InChIKey | HGNQULHOWJLTCX-GXTWGEPZSA-N |
| XLogP | 3.39 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.75 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |