C21H26N8O3 — CID 155883557
5-methyl-3-[[3-[(3R,5R)-5-(1-methylindazol-6-yl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,2,4a,5,6,7-hexahydropyrazolo[5,1-f][1,2,4]triazin-4-one (PubChem CID 155883557) has the molecular formula C21H26N8O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is 5-methyl-3-[[3-[(3R,5R)-5-(1-methylindazol-6-yl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,2,4a,5,6,7-hexahydropyrazolo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 5-methyl-3-[[3-[(3R,5R)-5-(1-methylindazol-6-yl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,2,4a,5,6,7-hexahydropyrazolo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 155883557 |
| Molecular Formula | C21H26N8O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 5-methyl-3-[[3-[(3R,5R)-5-(1-methylindazol-6-yl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,2,4a,5,6,7-hexahydropyrazolo[5,1-f][1,2,4]triazin-4-one |
| SMILES | CC1CNN2NCN(Cc3nc([C@@H]4CO[C@@H](c5ccc6cnn(C)c6c5)C4)no3)C(=O)C12 |
| InChI | InChI=1S/C21H26N8O3/c1-12-7-23-29-19(12)21(30)28(11-24-29)9-18-25-20(26-32-18)15-6-17(31-10-15)13-3-4-14-8-22-27(2)16(14)5-13/h3-5,8,12,15,17,19,23-24H,6-7,9-11H2,1-2H3/t12?,15-,17+,19?/m0/s1 |
| InChIKey | UXSPMTFCTJIBJO-OUGXULAESA-N |
| XLogP | 0.83 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |