C19H17ClF3N7O3 — CID 155883562
2-amino-3-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-7-(trifluoromethyl)-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 155883562) has the molecular formula C19H17ClF3N7O3 and a molecular weight of 483.84 g/mol. Its IUPAC name is 2-amino-3-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-7-(trifluoromethyl)-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-amino-3-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-7-(trifluoromethyl)-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 155883562 |
| Molecular Formula | C19H17ClF3N7O3 |
| Molecular Weight | 483.84 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 2-amino-3-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-7-(trifluoromethyl)-1,2-dihydroimidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | NC1Nn2c(cnc2C(F)(F)F)C(=O)N1Cc1nc([C@@H]2CO[C@@H](c3ccc(Cl)cc3)C2)no1 |
| InChI | InChI=1S/C19H17ClF3N7O3/c20-11-3-1-9(2-4-11)13-5-10(8-32-13)15-26-14(33-28-15)7-29-16(31)12-6-25-17(19(21,22)23)30(12)27-18(29)24/h1-4,6,10,13,18,27H,5,7-8,24H2/t10-,13+,18?/m0/s1 |
| InChIKey | UCVHIJWBAGSBSX-WCGGOGPHSA-N |
| XLogP | 2.63 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |