C16H16ClN3O2 — CID 155883748
2-(5-chloro-3a,7a-dihydropyrrolo[3,2-b]pyridin-1-yl)-N-hydroxy-3-phenylpropanamide (PubChem CID 155883748) has the molecular formula C16H16ClN3O2 and a molecular weight of 317.78 g/mol. Its IUPAC name is 2-(5-chloro-3a,7a-dihydropyrrolo[3,2-b]pyridin-1-yl)-N-hydroxy-3-phenylpropanamide.
| Compound Name | 2-(5-chloro-3a,7a-dihydropyrrolo[3,2-b]pyridin-1-yl)-N-hydroxy-3-phenylpropanamide |
|---|---|
| PubChem CID | 155883748 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-(5-chloro-3a,7a-dihydropyrrolo[3,2-b]pyridin-1-yl)-N-hydroxy-3-phenylpropanamide |
| SMILES | O=C(NO)C(Cc1ccccc1)N1C=CC2N=C(Cl)C=CC21 |
| InChI | InChI=1S/C16H16ClN3O2/c17-15-7-6-13-12(18-15)8-9-20(13)14(16(21)19-22)10-11-4-2-1-3-5-11/h1-9,12-14,22H,10H2,(H,19,21) |
| InChIKey | ZYPMUKFMLASFOE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|