C21H23N5O3 — CID 155883910
N-(4-methoxy-2-pyridinyl)-2,5-dimethyl-7-oxo-3-phenyl-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 155883910) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-(4-methoxy-2-pyridinyl)-2,5-dimethyl-7-oxo-3-phenyl-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(4-methoxy-2-pyridinyl)-2,5-dimethyl-7-oxo-3-phenyl-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 155883910 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-(4-methoxy-2-pyridinyl)-2,5-dimethyl-7-oxo-3-phenyl-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccnc(NC(=O)C2=C(C)NC3C(c4ccccc4)C(C)NN3C2=O)c1 |
| InChI | InChI=1S/C21H23N5O3/c1-12-18(20(27)24-16-11-15(29-3)9-10-22-16)21(28)26-19(23-12)17(13(2)25-26)14-7-5-4-6-8-14/h4-11,13,17,19,23,25H,1-3H3,(H,22,24,27) |
| InChIKey | NBTAJYMQQDVSHN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|