C23H25F3N4O3 — CID 155883971
6-(5-cyclopentyl-1,3-oxazol-2-yl)-5-(methoxymethyl)-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 155883971) has the molecular formula C23H25F3N4O3 and a molecular weight of 462.47 g/mol. Its IUPAC name is 6-(5-cyclopentyl-1,3-oxazol-2-yl)-5-(methoxymethyl)-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 6-(5-cyclopentyl-1,3-oxazol-2-yl)-5-(methoxymethyl)-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 155883971 |
| Molecular Formula | C23H25F3N4O3 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 6-(5-cyclopentyl-1,3-oxazol-2-yl)-5-(methoxymethyl)-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | COCC1=C(c2ncc(C3CCCC3)o2)C(=O)N2NC(C(F)(F)F)C(c3ccccc3)C2N1 |
| InChI | InChI=1S/C23H25F3N4O3/c1-32-12-15-18(21-27-11-16(33-21)13-7-5-6-8-13)22(31)30-20(28-15)17(14-9-3-2-4-10-14)19(29-30)23(24,25)26/h2-4,9-11,13,17,19-20,28-29H,5-8,12H2,1H3 |
| InChIKey | CXHVXUQGWQLZRN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |