C24H22F3N5O4 — CID 155884042
[2-[5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-6-yl]-1,3-benzoxazol-4-yl] N,N-dimethylcarbamate (PubChem CID 155884042) has the molecular formula C24H22F3N5O4 and a molecular weight of 501.47 g/mol. Its IUPAC name is [2-[5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-6-yl]-1,3-benzoxazol-4-yl] N,N-dimethylcarbamate.
| Compound Name | [2-[5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-6-yl]-1,3-benzoxazol-4-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 155884042 |
| Molecular Formula | C24H22F3N5O4 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | [2-[5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-6-yl]-1,3-benzoxazol-4-yl] N,N-dimethylcarbamate |
| SMILES | CC1=C(c2nc3c(OC(=O)N(C)C)cccc3o2)C(=O)N2NC(C(F)(F)F)C(c3ccccc3)C2N1 |
| InChI | InChI=1S/C24H22F3N5O4/c1-12-16(21-29-18-14(35-21)10-7-11-15(18)36-23(34)31(2)3)22(33)32-20(28-12)17(13-8-5-4-6-9-13)19(30-32)24(25,26)27/h4-11,17,19-20,28,30H,1-3H3 |
| InChIKey | ADTPVBVIMWNZGM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |