C19H19F3N4O3 — CID 155884062
6-[4-(methoxymethyl)-1,3-oxazol-2-yl]-5-methyl-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 155884062) has the molecular formula C19H19F3N4O3 and a molecular weight of 408.38 g/mol. Its IUPAC name is 6-[4-(methoxymethyl)-1,3-oxazol-2-yl]-5-methyl-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 6-[4-(methoxymethyl)-1,3-oxazol-2-yl]-5-methyl-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 155884062 |
| Molecular Formula | C19H19F3N4O3 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 6-[4-(methoxymethyl)-1,3-oxazol-2-yl]-5-methyl-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | COCc1coc(C2=C(C)NC3C(c4ccccc4)C(C(F)(F)F)NN3C2=O)n1 |
| InChI | InChI=1S/C19H19F3N4O3/c1-10-13(17-24-12(8-28-2)9-29-17)18(27)26-16(23-10)14(11-6-4-3-5-7-11)15(25-26)19(20,21)22/h3-7,9,14-16,23,25H,8H2,1-2H3 |
| InChIKey | GLXOCMNUTQAUEZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |