C24H25F3N4O4 — CID 155884119
5-cyclohexyl-2-[5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-6-yl]-1,3-oxazole-4-carboxylic acid (PubChem CID 155884119) has the molecular formula C24H25F3N4O4 and a molecular weight of 490.48 g/mol. Its IUPAC name is 5-cyclohexyl-2-[5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-6-yl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 5-cyclohexyl-2-[5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-6-yl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 155884119 |
| Molecular Formula | C24H25F3N4O4 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 5-cyclohexyl-2-[5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-6-yl]-1,3-oxazole-4-carboxylic acid |
| SMILES | CC1=C(c2nc(C(=O)O)c(C3CCCCC3)o2)C(=O)N2NC(C(F)(F)F)C(c3ccccc3)C2N1 |
| InChI | InChI=1S/C24H25F3N4O4/c1-12-15(21-29-17(23(33)34)18(35-21)14-10-6-3-7-11-14)22(32)31-20(28-12)16(13-8-4-2-5-9-13)19(30-31)24(25,26)27/h2,4-5,8-9,14,16,19-20,28,30H,3,6-7,10-11H2,1H3,(H,33,34) |
| InChIKey | GDWVDFPLCVEHRJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |