C23H23N3O6 — CID 155884619
2-N,6-N-bis[(2-hydroxy-3-methoxyphenyl)methyl]pyridine-2,6-dicarboxamide (PubChem CID 155884619) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is 2-N,6-N-bis[(2-hydroxy-3-methoxyphenyl)methyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[(2-hydroxy-3-methoxyphenyl)methyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 155884619 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-N,6-N-bis[(2-hydroxy-3-methoxyphenyl)methyl]pyridine-2,6-dicarboxamide |
| SMILES | COc1cccc(CNC(=O)c2cccc(C(=O)NCc3cccc(OC)c3O)n2)c1O |
| InChI | InChI=1S/C23H23N3O6/c1-31-18-10-3-6-14(20(18)27)12-24-22(29)16-8-5-9-17(26-16)23(30)25-13-15-7-4-11-19(32-2)21(15)28/h3-11,27-28H,12-13H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | WROOFJOLZZAAAP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|