C23H29N — CID 155885052
1-(2,6-diethylphenyl)-3,5,5-trimethyl-3-phenyl-2,4-dihydropyrrol-1-ium-2-ide (PubChem CID 155885052) has the molecular formula C23H29N and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3,5,5-trimethyl-3-phenyl-2,4-dihydropyrrol-1-ium-2-ide.
| Compound Name | 1-(2,6-diethylphenyl)-3,5,5-trimethyl-3-phenyl-2,4-dihydropyrrol-1-ium-2-ide |
|---|---|
| PubChem CID | 155885052 |
| Molecular Formula | C23H29N |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3,5,5-trimethyl-3-phenyl-2,4-dihydropyrrol-1-ium-2-ide |
| SMILES | CCc1cccc(CC)c1[N+]1=[C-]C(C)(c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C23H29N/c1-6-18-12-11-13-19(7-2)21(18)24-17-23(5,16-22(24,3)4)20-14-9-8-10-15-20/h8-15H,6-7,16H2,1-5H3 |
| InChIKey | OPQUBSRVSBLZAO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|