C36H45ClN2Pd+ — CID 155885081
Palladium, (1,3-bis(2,6-bis(1-methylethyl)phenyl)-1,3-dihydro-2H-imidazol-2-ylidene)chloro((1,2,3-eta)-(2E)-3-phenyl-2-propen-1-yl, stereoisomer (PubChem CID 155885081) has the molecular formula C36H45ClN2Pd+ and a molecular weight of 647.64 g/mol.
| Compound Name | Palladium, (1,3-bis(2,6-bis(1-methylethyl)phenyl)-1,3-dihydro-2H-imidazol-2-ylidene)chloro((1,2,3-eta)-(2E)-3-phenyl-2-propen-1-yl, stereoisomer |
|---|---|
| PubChem CID | 155885081 |
| Molecular Formula | C36H45ClN2Pd+ |
| Molecular Weight | 647.64 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | — |
| SMILES | C=C[CH]c1ccccc1.CC(C)c1cccc(C(C)C)c1-n1[c-][n+](-c2c(C(C)C)cccc2C(C)C)cc1.Cl[Pd+] |
| InChI | InChI=1S/C27H36N2.C9H9.ClH.Pd/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;1-2-6-9-7-4-3-5-8-9;;/h9-16,18-21H,1-8H3;2-8H,1H2;1H;/q;;;+2/p-1 |
| InChIKey | ZSQLWNDIAPSYRQ-UHFFFAOYSA-M |
| XLogP | 10.16 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.64 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|