C32H32Cl2N4O8 — CID 15588591
3-methyl-1-[4-(3-methyl-2-phenylimidazo[1,2-a]pyridin-1-ium-1-yl)butyl]-2-phenylimidazo[1,2-a]pyridin-1-ium diperchlorate (PubChem CID 15588591) has the molecular formula C32H32Cl2N4O8 and a molecular weight of 671.53 g/mol. Its IUPAC name is 3-methyl-1-[4-(3-methyl-2-phenylimidazo[1,2-a]pyridin-1-ium-1-yl)butyl]-2-phenylimidazo[1,2-a]pyridin-1-ium diperchlorate.
| Compound Name | 3-methyl-1-[4-(3-methyl-2-phenylimidazo[1,2-a]pyridin-1-ium-1-yl)butyl]-2-phenylimidazo[1,2-a]pyridin-1-ium diperchlorate |
|---|---|
| PubChem CID | 15588591 |
| Molecular Formula | C32H32Cl2N4O8 |
| Molecular Weight | 671.53 g/mol |
| Exact Mass | 670.16 |
| IUPAC Name | 3-methyl-1-[4-(3-methyl-2-phenylimidazo[1,2-a]pyridin-1-ium-1-yl)butyl]-2-phenylimidazo[1,2-a]pyridin-1-ium diperchlorate |
| SMILES | Cc1c(-c2ccccc2)[n+](CCCC[n+]2c(-c3ccccc3)c(C)n3ccccc32)c2ccccn12.[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C32H32N4.2ClHO4/c1-25-31(27-15-5-3-6-16-27)35(29-19-9-11-21-33(25)29)23-13-14-24-36-30-20-10-12-22-34(30)26(2)32(36)28-17-7-4-8-18-28;2*2-1(3,4)5/h3-12,15-22H,13-14,23-24H2,1-2H3;2*(H,2,3,4,5)/q+2;;/p-2 |
| InChIKey | QAHOPNFMOGCXCG-UHFFFAOYSA-L |
| XLogP | -3.31 |
| TPSA | 201.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.53 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|