C34H36N4O2+2 — CID 15588593
2-(4-methoxyphenyl)-1-[6-[2-(4-methoxyphenyl)imidazo[1,2-a]pyridin-4-ium-1-yl]hexyl]imidazo[1,2-a]pyridin-4-ium (PubChem CID 15588593) has the molecular formula C34H36N4O2+2 and a molecular weight of 532.69 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-[6-[2-(4-methoxyphenyl)imidazo[1,2-a]pyridin-4-ium-1-yl]hexyl]imidazo[1,2-a]pyridin-4-ium.
| Compound Name | 2-(4-methoxyphenyl)-1-[6-[2-(4-methoxyphenyl)imidazo[1,2-a]pyridin-4-ium-1-yl]hexyl]imidazo[1,2-a]pyridin-4-ium |
|---|---|
| PubChem CID | 15588593 |
| Molecular Formula | C34H36N4O2+2 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-[6-[2-(4-methoxyphenyl)imidazo[1,2-a]pyridin-4-ium-1-yl]hexyl]imidazo[1,2-a]pyridin-4-ium |
| SMILES | COc1ccc(-c2c[n+]3ccccc3n2CCCCCCn2c(-c3ccc(OC)cc3)c[n+]3ccccc23)cc1 |
| InChI | InChI=1S/C34H36N4O2/c1-39-29-17-13-27(14-18-29)31-25-35-21-9-5-11-33(35)37(31)23-7-3-4-8-24-38-32(26-36-22-10-6-12-34(36)38)28-15-19-30(40-2)20-16-28/h5-6,9-22,25-26H,3-4,7-8,23-24H2,1-2H3/q+2 |
| InChIKey | GZNYAOYTYYALAH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 36.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|