C32H30Br2N4+2 — CID 15588596
2-(4-bromophenyl)-1-[6-[2-(4-bromophenyl)imidazo[1,2-a]pyridin-4-ium-1-yl]hexyl]imidazo[1,2-a]pyridin-4-ium (PubChem CID 15588596) has the molecular formula C32H30Br2N4+2 and a molecular weight of 630.43 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-[6-[2-(4-bromophenyl)imidazo[1,2-a]pyridin-4-ium-1-yl]hexyl]imidazo[1,2-a]pyridin-4-ium.
| Compound Name | 2-(4-bromophenyl)-1-[6-[2-(4-bromophenyl)imidazo[1,2-a]pyridin-4-ium-1-yl]hexyl]imidazo[1,2-a]pyridin-4-ium |
|---|---|
| PubChem CID | 15588596 |
| Molecular Formula | C32H30Br2N4+2 |
| Molecular Weight | 630.43 g/mol |
| Exact Mass | 628.08 |
| IUPAC Name | 2-(4-bromophenyl)-1-[6-[2-(4-bromophenyl)imidazo[1,2-a]pyridin-4-ium-1-yl]hexyl]imidazo[1,2-a]pyridin-4-ium |
| SMILES | Brc1ccc(-c2c[n+]3ccccc3n2CCCCCCn2c(-c3ccc(Br)cc3)c[n+]3ccccc23)cc1 |
| InChI | InChI=1S/C32H30Br2N4/c33-27-15-11-25(12-16-27)29-23-35-19-7-3-9-31(35)37(29)21-5-1-2-6-22-38-30(26-13-17-28(34)18-14-26)24-36-20-8-4-10-32(36)38/h3-4,7-20,23-24H,1-2,5-6,21-22H2/q+2 |
| InChIKey | KTJMFFLUINLVDM-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 18.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.43 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|