C19H28BNO4 — CID 155887516
2-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-1-pyrrolidin-1-ylethanone (PubChem CID 155887516) has the molecular formula C19H28BNO4 and a molecular weight of 345.25 g/mol. Its IUPAC name is 2-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 155887516 |
| Molecular Formula | C19H28BNO4 |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 2-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-1-pyrrolidin-1-ylethanone |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1OCC(=O)N1CCCC1 |
| InChI | InChI=1S/C19H28BNO4/c1-14-12-15(20-24-18(2,3)19(4,5)25-20)8-9-16(14)23-13-17(22)21-10-6-7-11-21/h8-9,12H,6-7,10-11,13H2,1-5H3 |
| InChIKey | VYHKXKBNYUSIPN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|