About 5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one
5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one (PubChem CID 155887632) has the molecular formula C20H32O4
and a molecular weight of 336.47 g/mol. Its IUPAC name is 5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one.
Molecular Properties
| Compound Name | 5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one |
| PubChem CID | 155887632 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one |
| SMILES | CC/C=C/CCC1CCC(=O)O1.CCC=CCCC1CCC(=O)O1 |
| InChI | InChI=1S/2C10H16O2/c2*1-2-3-4-5-6-9-7-8-10(11)12-9/h2*3-4,9H,2,5-8H2,1H3/b4-3+; |
| InChIKey | KDMDJPLSSNBIHO-BJILWQEISA-N |
| XLogP | 4.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one?
The IUPAC name of 5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one (CID 155887632) is 5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one.
What is the SMILES notation for 5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one?
The canonical SMILES for 5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one is CC/C=C/CCC1CCC(=O)O1.CCC=CCCC1CCC(=O)O1.
What is the InChIKey of 5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one?
The InChIKey is KDMDJPLSSNBIHO-BJILWQEISA-N. The full InChI is InChI=1S/2C10H16O2/c2*1-2-3-4-5-6-9-7-8-10(11)12-9/h2*3-4,9H,2,5-8H2,1H3/b4-3+;.
What are the key properties of 5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one?
5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one has a molecular weight of 336.47 g/mol, XLogP of 4.88, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hex-3-enyloxolan-2-one;5-[(E)-hex-3-enyl]oxolan-2-one is sourced from PubChem (CID 155887632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).