About trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane
trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane (PubChem CID 155887691) has the molecular formula C16H32
and a molecular weight of 224.43 g/mol. Its IUPAC name is trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane.
Molecular Properties
| Compound Name | trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane |
| PubChem CID | 155887691 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane |
| SMILES | CC[C@@H]1CC[C@@H](C)C1.CC[C@H]1CC[C@H](C)C1 |
| InChI | InChI=1S/2C8H16/c2*1-3-8-5-4-7(2)6-8/h2*7-8H,3-6H2,1-2H3/t2*7-,8-/m10/s1 |
| InChIKey | UNWJKKQEYSVQEW-SRPOWUSQSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane?
The IUPAC name of trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane (CID 155887691) is trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane.
What is the SMILES notation for trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane?
The canonical SMILES for trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane is CC[C@@H]1CC[C@@H](C)C1.CC[C@H]1CC[C@H](C)C1.
What is the InChIKey of trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane?
The InChIKey is UNWJKKQEYSVQEW-SRPOWUSQSA-N. The full InChI is InChI=1S/2C8H16/c2*1-3-8-5-4-7(2)6-8/h2*7-8H,3-6H2,1-2H3/t2*7-,8-/m10/s1.
What are the key properties of trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane?
trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane has a molecular weight of 224.43 g/mol, XLogP of 5.67, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,3S)-1-ethyl-3-methylcyclopentane;trans-(1R,3R)-1-ethyl-3-methylcyclopentane is sourced from PubChem (CID 155887691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).