C22H28O2P2 — CID 155887893
(3S)-3-tert-butyl-2-[(3S)-3-tert-butyl-2H-1,3-benzoxaphosphol-2-yl]-2H-1,3-benzoxaphosphole (PubChem CID 155887893) has the molecular formula C22H28O2P2 and a molecular weight of 386.41 g/mol. Its IUPAC name is (3S)-3-tert-butyl-2-[(3S)-3-tert-butyl-2H-1,3-benzoxaphosphol-2-yl]-2H-1,3-benzoxaphosphole.
| Compound Name | (3S)-3-tert-butyl-2-[(3S)-3-tert-butyl-2H-1,3-benzoxaphosphol-2-yl]-2H-1,3-benzoxaphosphole |
|---|---|
| PubChem CID | 155887893 |
| Molecular Formula | C22H28O2P2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (3S)-3-tert-butyl-2-[(3S)-3-tert-butyl-2H-1,3-benzoxaphosphol-2-yl]-2H-1,3-benzoxaphosphole |
| SMILES | CC(C)(C)[P@@]1c2ccccc2OC1C1Oc2ccccc2[P@]1C(C)(C)C |
| InChI | InChI=1S/C22H28O2P2/c1-21(2,3)25-17-13-9-7-11-15(17)23-19(25)20-24-16-12-8-10-14-18(16)26(20)22(4,5)6/h7-14,19-20H,1-6H3/t19?,20?,25-,26-/m0/s1 |
| InChIKey | CAVTUIDTRDJLGP-TZNWWYNESA-N |
| XLogP | 5.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|