C25H28NO4P — CID 155887969
2-[(2R,3S)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphol-2-yl]-6-methoxypyridine (PubChem CID 155887969) has the molecular formula C25H28NO4P and a molecular weight of 437.48 g/mol. Its IUPAC name is 2-[(2R,3S)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphol-2-yl]-6-methoxypyridine.
| Compound Name | 2-[(2R,3S)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphol-2-yl]-6-methoxypyridine |
|---|---|
| PubChem CID | 155887969 |
| Molecular Formula | C25H28NO4P |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2-[(2R,3S)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphol-2-yl]-6-methoxypyridine |
| SMILES | COc1cccc([C@@H]2Oc3cccc(-c4c(OC)cccc4OC)c3[P@]2C(C)(C)C)n1 |
| InChI | InChI=1S/C25H28NO4P/c1-25(2,3)31-23-16(22-18(27-4)12-9-13-19(22)28-5)10-7-14-20(23)30-24(31)17-11-8-15-21(26-17)29-6/h7-15,24H,1-6H3/t24-,31+/m1/s1 |
| InChIKey | OMRMWFIEDFJLAJ-XJFCNFDWSA-N |
| XLogP | 5.77 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|