C41H55N7O7 — CID 155889039
9-(4-aminobutyl)-3-[(4-benzoylphenyl)methyl]-6-(cyclohexylmethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,15-pentazacycloicos-12-ene-16-carboxamide (PubChem CID 155889039) has the molecular formula C41H55N7O7 and a molecular weight of 757.93 g/mol. Its IUPAC name is 9-(4-aminobutyl)-3-[(4-benzoylphenyl)methyl]-6-(cyclohexylmethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,15-pentazacycloicos-12-ene-16-carboxamide.
| Compound Name | 9-(4-aminobutyl)-3-[(4-benzoylphenyl)methyl]-6-(cyclohexylmethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,15-pentazacycloicos-12-ene-16-carboxamide |
|---|---|
| PubChem CID | 155889039 |
| Molecular Formula | C41H55N7O7 |
| Molecular Weight | 757.93 g/mol |
| Exact Mass | 757.42 |
| IUPAC Name | 9-(4-aminobutyl)-3-[(4-benzoylphenyl)methyl]-6-(cyclohexylmethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,15-pentazacycloicos-12-ene-16-carboxamide |
| SMILES | NCCCCC1NC(=O)C=CC(=O)NC(C(N)=O)CCCCNC(=O)C(Cc2ccc(C(=O)c3ccccc3)cc2)NC(=O)C(CC2CCCCC2)NC1=O |
| InChI | InChI=1S/C41H55N7O7/c42-23-9-7-16-32-40(54)48-34(25-27-11-3-1-4-12-27)41(55)47-33(26-28-17-19-30(20-18-28)37(51)29-13-5-2-6-14-29)39(53)44-24-10-8-15-31(38(43)52)45-35(49)21-22-36(50)46-32/h2,5-6,13-14,17-22,27,31-34H,1,3-4,7-12,15-16,23-26,42H2,(H2,43,52)(H,44,53)(H,45,49)(H,46,50)(H,47,55)(H,48,54) |
| InChIKey | BHZABWWULWHRIY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 231.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.93 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|