C13H16N2S — CID 155891510
2-tert-butyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazole (PubChem CID 155891510) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 2-tert-butyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 2-tert-butyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 155891510 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-tert-butyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazole |
| SMILES | CC(C)(C)C1CN2C(=N1)Sc1ccccc12 |
| InChI | InChI=1S/C13H16N2S/c1-13(2,3)11-8-15-9-6-4-5-7-10(9)16-12(15)14-11/h4-7,11H,8H2,1-3H3 |
| InChIKey | UAPPJNKVYZLCEP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |