C36H41N2O2P — CID 155891829
bis[2-[(4R)-4-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-phenylphosphane (PubChem CID 155891829) has the molecular formula C36H41N2O2P and a molecular weight of 564.71 g/mol. Its IUPAC name is bis[2-[(4R)-4-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-phenylphosphane.
| Compound Name | bis[2-[(4R)-4-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-phenylphosphane |
|---|---|
| PubChem CID | 155891829 |
| Molecular Formula | C36H41N2O2P |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | bis[2-[(4R)-4-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-phenylphosphane |
| SMILES | c1ccc(P(c2ccccc2C2=N[C@H](C3CCCCC3)CO2)c2ccccc2C2=N[C@H](C3CCCCC3)CO2)cc1 |
| InChI | InChI=1S/C36H41N2O2P/c1-4-14-26(15-5-1)31-24-39-35(37-31)29-20-10-12-22-33(29)41(28-18-8-3-9-19-28)34-23-13-11-21-30(34)36-38-32(25-40-36)27-16-6-2-7-17-27/h3,8-13,18-23,26-27,31-32H,1-2,4-7,14-17,24-25H2/t31-,32-/m0/s1 |
| InChIKey | UNNXTSKUSPPYLJ-ACHIHNKUSA-N |
| XLogP | 6.90 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|