C11H23BO2 — CID 155892155
2-(2,2-dimethylpropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 155892155) has the molecular formula C11H23BO2 and a molecular weight of 198.11 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(2,2-dimethylpropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 155892155 |
| Molecular Formula | C11H23BO2 |
| Molecular Weight | 198.11 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C11H23BO2/c1-9(2,3)8-12-13-10(4,5)11(6,7)14-12/h8H2,1-7H3 |
| InChIKey | DEGKSAAWQXWFEA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.11 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|