C11H13N3O — CID 155892187
6-amino-2,3,4,4a,9,9a-hexahydropyrido[3,4-b]indol-1-one (PubChem CID 155892187) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 6-amino-2,3,4,4a,9,9a-hexahydropyrido[3,4-b]indol-1-one.
| Compound Name | 6-amino-2,3,4,4a,9,9a-hexahydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 155892187 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 6-amino-2,3,4,4a,9,9a-hexahydropyrido[3,4-b]indol-1-one |
| SMILES | Nc1ccc2c(c1)C1CCNC(=O)C1N2 |
| InChI | InChI=1S/C11H13N3O/c12-6-1-2-9-8(5-6)7-3-4-13-11(15)10(7)14-9/h1-2,5,7,10,14H,3-4,12H2,(H,13,15) |
| InChIKey | XYYVIIIJNLMCKL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|