C11H10BrF3N4 — CID 155892977
2-bromo-6-[4-(4,4,4-trifluorobutan-2-yl)-1,2,4-triazol-3-yl]pyridine (PubChem CID 155892977) has the molecular formula C11H10BrF3N4 and a molecular weight of 335.13 g/mol. Its IUPAC name is 2-bromo-6-[4-(4,4,4-trifluorobutan-2-yl)-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 2-bromo-6-[4-(4,4,4-trifluorobutan-2-yl)-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 155892977 |
| Molecular Formula | C11H10BrF3N4 |
| Molecular Weight | 335.13 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 2-bromo-6-[4-(4,4,4-trifluorobutan-2-yl)-1,2,4-triazol-3-yl]pyridine |
| SMILES | CC(CC(F)(F)F)n1cnnc1-c1cccc(Br)n1 |
| InChI | InChI=1S/C11H10BrF3N4/c1-7(5-11(13,14)15)19-6-16-18-10(19)8-3-2-4-9(12)17-8/h2-4,6-7H,5H2,1H3 |
| InChIKey | BMCXKIBNTDUUAB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.13 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|