C14H13FN2O2 — CID 155894486
1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazole-4-carboxylic acid (PubChem CID 155894486) has the molecular formula C14H13FN2O2 and a molecular weight of 260.27 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazole-4-carboxylic acid.
| Compound Name | 1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazole-4-carboxylic acid |
|---|---|
| PubChem CID | 155894486 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazole-4-carboxylic acid |
| SMILES | O=C(O)C1CCCc2c1cnn2-c1ccccc1F |
| InChI | InChI=1S/C14H13FN2O2/c15-11-5-1-2-6-13(11)17-12-7-3-4-9(14(18)19)10(12)8-16-17/h1-2,5-6,8-9H,3-4,7H2,(H,18,19) |
| InChIKey | GBCWOMVKAKRVJI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |