About starbld0041303
starbld0041303 (PubChem CID 155894831) has the molecular formula C14H19N2O2
and a molecular weight of 247.32 g/mol.
Molecular Properties
| Compound Name | starbld0041303 |
| PubChem CID | 155894831 |
| Molecular Formula | C14H19N2O2 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | — |
| SMILES | CC1(C)C(CO)=C(c2cccnc2)C(C)(C)N1[O] |
| InChI | InChI=1S/C14H19N2O2/c1-13(2)11(9-17)12(14(3,4)16(13)18)10-6-5-7-15-8-10/h5-8,17H,9H2,1-4H3 |
| InChIKey | SXIOFDIFSHSPAI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 56.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze starbld0041303 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of starbld0041303?
The IUPAC name of starbld0041303 (CID 155894831) is not available.
What is the SMILES notation for starbld0041303?
The canonical SMILES for starbld0041303 is CC1(C)C(CO)=C(c2cccnc2)C(C)(C)N1[O].
What is the InChIKey of starbld0041303?
The InChIKey is SXIOFDIFSHSPAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N2O2/c1-13(2)11(9-17)12(14(3,4)16(13)18)10-6-5-7-15-8-10/h5-8,17H,9H2,1-4H3.
What are the key properties of starbld0041303?
starbld0041303 has a molecular weight of 247.32 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for starbld0041303 is sourced from PubChem (CID 155894831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).