About methyl 20-bromoicosanoate
methyl 20-bromoicosanoate (PubChem CID 155895697) has the molecular formula C21H41BrO2
and a molecular weight of 405.46 g/mol. Its IUPAC name is methyl 20-bromoicosanoate.
Molecular Properties
| Compound Name | methyl 20-bromoicosanoate |
| PubChem CID | 155895697 |
| Molecular Formula | C21H41BrO2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | methyl 20-bromoicosanoate |
| SMILES | COC(=O)CCCCCCCCCCCCCCCCCCCBr |
| InChI | InChI=1S/C21H41BrO2/c1-24-21(23)19-17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-20-22/h2-20H2,1H3 |
| InChIKey | NJHLMXFOWHGHSK-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 20-bromoicosanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 20-bromoicosanoate?
The IUPAC name of methyl 20-bromoicosanoate (CID 155895697) is methyl 20-bromoicosanoate.
What is the SMILES notation for methyl 20-bromoicosanoate?
The canonical SMILES for methyl 20-bromoicosanoate is COC(=O)CCCCCCCCCCCCCCCCCCCBr.
What is the InChIKey of methyl 20-bromoicosanoate?
The InChIKey is NJHLMXFOWHGHSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H41BrO2/c1-24-21(23)19-17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-20-22/h2-20H2,1H3.
What are the key properties of methyl 20-bromoicosanoate?
methyl 20-bromoicosanoate has a molecular weight of 405.46 g/mol, XLogP of 7.58, 19 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 20-bromoicosanoate is sourced from PubChem (CID 155895697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).