C23H34FN3O5 — CID 155896343
tert-butyl 5-[4-fluoro-2-(3-methoxypropoxy)phenyl]-2-oxo-1,3,9-triazaspiro[5.5]undecane-9-carboxylate (PubChem CID 155896343) has the molecular formula C23H34FN3O5 and a molecular weight of 451.54 g/mol. Its IUPAC name is tert-butyl 5-[4-fluoro-2-(3-methoxypropoxy)phenyl]-2-oxo-1,3,9-triazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | tert-butyl 5-[4-fluoro-2-(3-methoxypropoxy)phenyl]-2-oxo-1,3,9-triazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 155896343 |
| Molecular Formula | C23H34FN3O5 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | tert-butyl 5-[4-fluoro-2-(3-methoxypropoxy)phenyl]-2-oxo-1,3,9-triazaspiro[5.5]undecane-9-carboxylate |
| SMILES | COCCCOc1cc(F)ccc1C1CNC(=O)NC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C23H34FN3O5/c1-22(2,3)32-21(29)27-10-8-23(9-11-27)18(15-25-20(28)26-23)17-7-6-16(24)14-19(17)31-13-5-12-30-4/h6-7,14,18H,5,8-13,15H2,1-4H3,(H2,25,26,28) |
| InChIKey | KQAFCHASERAYRT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|