About 6,6-dimethyl-1,4,5,7-tetrahydropyrrolo[3,2-c]pyridine
6,6-dimethyl-1,4,5,7-tetrahydropyrrolo[3,2-c]pyridine (PubChem CID 155896448) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 6,6-dimethyl-1,4,5,7-tetrahydropyrrolo[3,2-c]pyridine.
Analyze 6,6-dimethyl-1,4,5,7-tetrahydropyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-1,4,5,7-tetrahydropyrrolo[3,2-c]pyridine?
The IUPAC name of 6,6-dimethyl-1,4,5,7-tetrahydropyrrolo[3,2-c]pyridine (CID 155896448) is 6,6-dimethyl-1,4,5,7-tetrahydropyrrolo[3,2-c]pyridine.
What is the SMILES notation for 6,6-dimethyl-1,4,5,7-tetrahydropyrrolo[3,2-c]pyridine?
The canonical SMILES for 6,6-dimethyl-1,4,5,7-tetrahydropyrrolo[3,2-c]pyridine is CC1(C)Cc2[nH]ccc2CN1.
What is the InChIKey of 6,6-dimethyl-1,4,5,7-tetrahydropyrrolo[3,2-c]pyridine?
The InChIKey is BYROQIHBFFWRLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-9(2)5-8-7(6-11-9)3-4-10-8/h3-4,10-11H,5-6H2,1-2H3.
What are the key properties of 6,6-dimethyl-1,4,5,7-tetrahydropyrrolo[3,2-c]pyridine?
6,6-dimethyl-1,4,5,7-tetrahydropyrrolo[3,2-c]pyridine has a molecular weight of 150.22 g/mol, XLogP of 1.44, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-1,4,5,7-tetrahydropyrrolo[3,2-c]pyridine is sourced from PubChem (CID 155896448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).