C13H20ClNO — CID 155896532
2-(3-cyclopentyloxyphenyl)ethanamine;hydrochloride (PubChem CID 155896532) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is 2-(3-cyclopentyloxyphenyl)ethanamine;hydrochloride.
| Compound Name | 2-(3-cyclopentyloxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 155896532 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-(3-cyclopentyloxyphenyl)ethanamine;hydrochloride |
| SMILES | Cl.NCCc1cccc(OC2CCCC2)c1 |
| InChI | InChI=1S/C13H19NO.ClH/c14-9-8-11-4-3-7-13(10-11)15-12-5-1-2-6-12;/h3-4,7,10,12H,1-2,5-6,8-9,14H2;1H |
| InChIKey | XGLKZTFCFVNTHL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |