C13H18O2 — CID 155896822
1-[(2,3-dimethylphenoxy)methyl]cyclobutan-1-ol (PubChem CID 155896822) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-[(2,3-dimethylphenoxy)methyl]cyclobutan-1-ol.
| Compound Name | 1-[(2,3-dimethylphenoxy)methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 155896822 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1-[(2,3-dimethylphenoxy)methyl]cyclobutan-1-ol |
| SMILES | Cc1cccc(OCC2(O)CCC2)c1C |
| InChI | InChI=1S/C13H18O2/c1-10-5-3-6-12(11(10)2)15-9-13(14)7-4-8-13/h3,5-6,14H,4,7-9H2,1-2H3 |
| InChIKey | MCCNUFQAJHNWTR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |