About 1H-imidazol-2-ylboronic acid;dihydrochloride
1H-imidazol-2-ylboronic acid;dihydrochloride (PubChem CID 155897336) has the molecular formula C3H7BCl2N2O2
and a molecular weight of 184.82 g/mol. Its IUPAC name is 1H-imidazol-2-ylboronic acid;dihydrochloride.
Molecular Properties
| Compound Name | 1H-imidazol-2-ylboronic acid;dihydrochloride |
| PubChem CID | 155897336 |
| Molecular Formula | C3H7BCl2N2O2 |
| Molecular Weight | 184.82 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | 1H-imidazol-2-ylboronic acid;dihydrochloride |
| SMILES | Cl.Cl.OB(O)c1ncc[nH]1 |
| InChI | InChI=1S/C3H5BN2O2.2ClH/c7-4(8)3-5-1-2-6-3;;/h1-2,7-8H,(H,5,6);2*1H |
| InChIKey | AYCKHXZLLXSIFI-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.82 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazol-2-ylboronic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazol-2-ylboronic acid;dihydrochloride?
The IUPAC name of 1H-imidazol-2-ylboronic acid;dihydrochloride (CID 155897336) is 1H-imidazol-2-ylboronic acid;dihydrochloride.
What is the SMILES notation for 1H-imidazol-2-ylboronic acid;dihydrochloride?
The canonical SMILES for 1H-imidazol-2-ylboronic acid;dihydrochloride is Cl.Cl.OB(O)c1ncc[nH]1.
What is the InChIKey of 1H-imidazol-2-ylboronic acid;dihydrochloride?
The InChIKey is AYCKHXZLLXSIFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5BN2O2.2ClH/c7-4(8)3-5-1-2-6-3;;/h1-2,7-8H,(H,5,6);2*1H.
What are the key properties of 1H-imidazol-2-ylboronic acid;dihydrochloride?
1H-imidazol-2-ylboronic acid;dihydrochloride has a molecular weight of 184.82 g/mol, XLogP of -1.07, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazol-2-ylboronic acid;dihydrochloride is sourced from PubChem (CID 155897336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).