C14H12ClFN4O4 — CID 155898325
2-[2-chloro-6-(furan-2-yl)purin-9-yl]-4-fluoro-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 155898325) has the molecular formula C14H12ClFN4O4 and a molecular weight of 354.73 g/mol. Its IUPAC name is 2-[2-chloro-6-(furan-2-yl)purin-9-yl]-4-fluoro-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | 2-[2-chloro-6-(furan-2-yl)purin-9-yl]-4-fluoro-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 155898325 |
| Molecular Formula | C14H12ClFN4O4 |
| Molecular Weight | 354.73 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2-[2-chloro-6-(furan-2-yl)purin-9-yl]-4-fluoro-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | OCC1OC(n2cnc3c(-c4ccco4)nc(Cl)nc32)C(O)C1F |
| InChI | InChI=1S/C14H12ClFN4O4/c15-14-18-9(6-2-1-3-23-6)10-12(19-14)20(5-17-10)13-11(22)8(16)7(4-21)24-13/h1-3,5,7-8,11,13,21-22H,4H2 |
| InChIKey | FUAYUQXTQUOELP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.73 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |