C8H11NO7 — CID 155898897
4-[(1S,2R)-1-amino-1-carboxypropan-2-yl]oxy-2,4-dioxobutanoic acid (PubChem CID 155898897) has the molecular formula C8H11NO7 and a molecular weight of 233.18 g/mol. Its IUPAC name is 4-[(1S,2R)-1-amino-1-carboxypropan-2-yl]oxy-2,4-dioxobutanoic acid.
| Compound Name | 4-[(1S,2R)-1-amino-1-carboxypropan-2-yl]oxy-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 155898897 |
| Molecular Formula | C8H11NO7 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 4-[(1S,2R)-1-amino-1-carboxypropan-2-yl]oxy-2,4-dioxobutanoic acid |
| SMILES | C[C@@H](OC(=O)CC(=O)C(=O)O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H11NO7/c1-3(6(9)8(14)15)16-5(11)2-4(10)7(12)13/h3,6H,2,9H2,1H3,(H,12,13)(H,14,15)/t3-,6+/m1/s1 |
| InChIKey | SGLZDAOAICDMAX-CVYQJGLWSA-N |
| XLogP | -1.63 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|