C20H24FN3O2S — CID 155899179
7-(cyclopentylamino)-5-fluoro-2-[[(1R,4R)-4-hydroxycyclohex-2-en-1-yl]sulfanylmethyl]-3H-quinazolin-4-one (PubChem CID 155899179) has the molecular formula C20H24FN3O2S and a molecular weight of 389.50 g/mol. Its IUPAC name is 7-(cyclopentylamino)-5-fluoro-2-[[(1R,4R)-4-hydroxycyclohex-2-en-1-yl]sulfanylmethyl]-3H-quinazolin-4-one.
| Compound Name | 7-(cyclopentylamino)-5-fluoro-2-[[(1R,4R)-4-hydroxycyclohex-2-en-1-yl]sulfanylmethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 155899179 |
| Molecular Formula | C20H24FN3O2S |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 7-(cyclopentylamino)-5-fluoro-2-[[(1R,4R)-4-hydroxycyclohex-2-en-1-yl]sulfanylmethyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CS[C@H]2C=C[C@H](O)CC2)nc2cc(NC3CCCC3)cc(F)c12 |
| InChI | InChI=1S/C20H24FN3O2S/c21-16-9-13(22-12-3-1-2-4-12)10-17-19(16)20(26)24-18(23-17)11-27-15-7-5-14(25)6-8-15/h5,7,9-10,12,14-15,22,25H,1-4,6,8,11H2,(H,23,24,26)/t14-,15-/m0/s1 |
| InChIKey | QOPJCLORLYDHKJ-GJZGRUSLSA-N |
| XLogP | 3.73 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|