C18H28N4O3 — CID 155900122
N-[[(2R,3aR,4S,8aR)-1-acetyl-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-2-yl]methyl]-2-methylpyrazole-3-carboxamide (PubChem CID 155900122) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[[(2R,3aR,4S,8aR)-1-acetyl-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-2-yl]methyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[[(2R,3aR,4S,8aR)-1-acetyl-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-2-yl]methyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 155900122 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-[[(2R,3aR,4S,8aR)-1-acetyl-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-2-yl]methyl]-2-methylpyrazole-3-carboxamide |
| SMILES | CC(=O)N1[C@@H](CNC(=O)c2ccnn2C)C[C@@]2(C)[C@@H](O)CCCC[C@@H]12 |
| InChI | InChI=1S/C18H28N4O3/c1-12(23)22-13(11-19-17(25)14-8-9-20-21(14)3)10-18(2)15(22)6-4-5-7-16(18)24/h8-9,13,15-16,24H,4-7,10-11H2,1-3H3,(H,19,25)/t13-,15-,16+,18-/m1/s1 |
| InChIKey | GTSXOFDYBVQQLJ-NYCLONFESA-N |
| XLogP | 1.08 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |