C17H28N6O — CID 155900607
9-methyl-4-(pentylamino)-6-pyrrolidin-3-yl-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one (PubChem CID 155900607) has the molecular formula C17H28N6O and a molecular weight of 332.45 g/mol. Its IUPAC name is 9-methyl-4-(pentylamino)-6-pyrrolidin-3-yl-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one.
| Compound Name | 9-methyl-4-(pentylamino)-6-pyrrolidin-3-yl-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one |
|---|---|
| PubChem CID | 155900607 |
| Molecular Formula | C17H28N6O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 9-methyl-4-(pentylamino)-6-pyrrolidin-3-yl-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one |
| SMILES | CCCCCNc1ncnc2c1CN(C1CCNC1)C(=O)CN2C |
| InChI | InChI=1S/C17H28N6O/c1-3-4-5-7-19-16-14-10-23(13-6-8-18-9-13)15(24)11-22(2)17(14)21-12-20-16/h12-13,18H,3-11H2,1-2H3,(H,19,20,21) |
| InChIKey | HAAAHHXYYXGZRG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|