C18H24N2O4 — CID 155900882
8-O-ethyl 2-O-methyl (7S,8R,8aS)-7-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxylate (PubChem CID 155900882) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 8-O-ethyl 2-O-methyl (7S,8R,8aS)-7-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxylate.
| Compound Name | 8-O-ethyl 2-O-methyl (7S,8R,8aS)-7-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxylate |
|---|---|
| PubChem CID | 155900882 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 8-O-ethyl 2-O-methyl (7S,8R,8aS)-7-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](c2ccccc2)CN2CCN(C(=O)OC)C[C@H]12 |
| InChI | InChI=1S/C18H24N2O4/c1-3-24-17(21)16-14(13-7-5-4-6-8-13)11-19-9-10-20(12-15(16)19)18(22)23-2/h4-8,14-16H,3,9-12H2,1-2H3/t14-,15-,16-/m1/s1 |
| InChIKey | NXARRUTYIORTLT-BZUAXINKSA-N |
| XLogP | 1.72 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |