C23H33FN4O2 — CID 155901074
(3aS,6aR)-5-ethyl-N-(4-fluorophenyl)-2-(2-methylpropyl)-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1'-carboxamide (PubChem CID 155901074) has the molecular formula C23H33FN4O2 and a molecular weight of 416.54 g/mol. Its IUPAC name is (3aS,6aR)-5-ethyl-N-(4-fluorophenyl)-2-(2-methylpropyl)-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1'-carboxamide.
| Compound Name | (3aS,6aR)-5-ethyl-N-(4-fluorophenyl)-2-(2-methylpropyl)-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 155901074 |
| Molecular Formula | C23H33FN4O2 |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (3aS,6aR)-5-ethyl-N-(4-fluorophenyl)-2-(2-methylpropyl)-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1'-carboxamide |
| SMILES | CCN1C(=O)[C@H]2CN(CC(C)C)C[C@H]2C12CCN(C(=O)Nc1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C23H33FN4O2/c1-4-28-21(29)19-14-26(13-16(2)3)15-20(19)23(28)9-11-27(12-10-23)22(30)25-18-7-5-17(24)6-8-18/h5-8,16,19-20H,4,9-15H2,1-3H3,(H,25,30)/t19-,20+/m0/s1 |
| InChIKey | LBKUTCQIMKDJSE-VQTJNVASSA-N |
| XLogP | 3.26 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |