C17H24FN5O2 — CID 155901344
[(3aR,5R,7aR)-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 155901344) has the molecular formula C17H24FN5O2 and a molecular weight of 349.41 g/mol. Its IUPAC name is [(3aR,5R,7aR)-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [(3aR,5R,7aR)-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 155901344 |
| Molecular Formula | C17H24FN5O2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | [(3aR,5R,7aR)-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)[C@H]2CC[C@@H]3[C@@H](CCN3c3ncc(F)cn3)O2)CC1 |
| InChI | InChI=1S/C17H24FN5O2/c1-21-6-8-22(9-7-21)16(24)15-3-2-13-14(25-15)4-5-23(13)17-19-10-12(18)11-20-17/h10-11,13-15H,2-9H2,1H3/t13-,14-,15-/m1/s1 |
| InChIKey | UXMKLQIPIMDLGL-RBSFLKMASA-N |
| XLogP | 0.52 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |