C15H23N5O3 — CID 155901715
3-[(3R,3aR,7aR)-1-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea (PubChem CID 155901715) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-[(3R,3aR,7aR)-1-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea.
| Compound Name | 3-[(3R,3aR,7aR)-1-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 155901715 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 3-[(3R,3aR,7aR)-1-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea |
| SMILES | COc1cc(N2C[C@@H](NC(=O)N(C)C)[C@H]3OCCC[C@H]32)ncn1 |
| InChI | InChI=1S/C15H23N5O3/c1-19(2)15(21)18-10-8-20(11-5-4-6-23-14(10)11)12-7-13(22-3)17-9-16-12/h7,9-11,14H,4-6,8H2,1-3H3,(H,18,21)/t10-,11-,14-/m1/s1 |
| InChIKey | HQPMMCVUCWMYEN-JTNHKYCSSA-N |
| XLogP | 0.49 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |