C26H32N2O5 — CID 155901953
1-[(4aS,10bS)-7-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-pyridin-3-yloxyethanone (PubChem CID 155901953) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is 1-[(4aS,10bS)-7-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-pyridin-3-yloxyethanone.
| Compound Name | 1-[(4aS,10bS)-7-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-pyridin-3-yloxyethanone |
|---|---|
| PubChem CID | 155901953 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 1-[(4aS,10bS)-7-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-pyridin-3-yloxyethanone |
| SMILES | COc1cccc2c1OC(C)(C)[C@H]1CC3(CCN(C(=O)COc4cccnc4)CC3)CO[C@H]21 |
| InChI | InChI=1S/C26H32N2O5/c1-25(2)20-14-26(17-32-23(20)19-7-4-8-21(30-3)24(19)33-25)9-12-28(13-10-26)22(29)16-31-18-6-5-11-27-15-18/h4-8,11,15,20,23H,9-10,12-14,16-17H2,1-3H3/t20-,23+/m0/s1 |
| InChIKey | ONPIQTXZNMQGGK-NZQKXSOJSA-N |
| XLogP | 4.03 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |