About [4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone
[4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone (PubChem CID 155901969) has the molecular formula C17H23N5OS
and a molecular weight of 345.47 g/mol. Its IUPAC name is [4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone.
Molecular Properties
| Compound Name | [4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone |
| PubChem CID | 155901969 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone |
| SMILES | CNc1cnc(CC2CCCN(C(=O)c3scnc3C)CC2)cn1 |
| InChI | InChI=1S/C17H23N5OS/c1-12-16(24-11-21-12)17(23)22-6-3-4-13(5-7-22)8-14-9-20-15(18-2)10-19-14/h9-11,13H,3-8H2,1-2H3,(H,18,20) |
| InChIKey | AIOHTNFJAUODJZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone?
The IUPAC name of [4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone (CID 155901969) is [4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone.
What is the SMILES notation for [4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone?
The canonical SMILES for [4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone is CNc1cnc(CC2CCCN(C(=O)c3scnc3C)CC2)cn1.
What is the InChIKey of [4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone?
The InChIKey is AIOHTNFJAUODJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N5OS/c1-12-16(24-11-21-12)17(23)22-6-3-4-13(5-7-22)8-14-9-20-15(18-2)10-19-14/h9-11,13H,3-8H2,1-2H3,(H,18,20).
What are the key properties of [4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone?
[4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone has a molecular weight of 345.47 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[5-(methylamino)pyrazin-2-yl]methyl]azepan-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone is sourced from PubChem (CID 155901969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).