C20H25N3O3S — CID 155902200
3-(2-methoxyphenyl)sulfonyl-6-methyl-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzodiazepine (PubChem CID 155902200) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)sulfonyl-6-methyl-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzodiazepine.
| Compound Name | 3-(2-methoxyphenyl)sulfonyl-6-methyl-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzodiazepine |
|---|---|
| PubChem CID | 155902200 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 3-(2-methoxyphenyl)sulfonyl-6-methyl-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzodiazepine |
| SMILES | COc1ccccc1S(=O)(=O)N1CCN2Cc3ccccc3N(C)CC2C1 |
| InChI | InChI=1S/C20H25N3O3S/c1-21-14-17-15-23(27(24,25)20-10-6-5-9-19(20)26-2)12-11-22(17)13-16-7-3-4-8-18(16)21/h3-10,17H,11-15H2,1-2H3 |
| InChIKey | MWDQYQWMLJZQQU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |