C18H15N5OS — CID 155902309
6-phenylmethoxy-8-[(E)-2-thiophen-2-ylethenyl]-7H-purin-2-amine (PubChem CID 155902309) has the molecular formula C18H15N5OS and a molecular weight of 349.42 g/mol. Its IUPAC name is 6-phenylmethoxy-8-[(E)-2-thiophen-2-ylethenyl]-7H-purin-2-amine.
| Compound Name | 6-phenylmethoxy-8-[(E)-2-thiophen-2-ylethenyl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 155902309 |
| Molecular Formula | C18H15N5OS |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 6-phenylmethoxy-8-[(E)-2-thiophen-2-ylethenyl]-7H-purin-2-amine |
| SMILES | Nc1nc(OCc2ccccc2)c2[nH]c(/C=C/c3cccs3)nc2n1 |
| InChI | InChI=1S/C18H15N5OS/c19-18-22-16-15(17(23-18)24-11-12-5-2-1-3-6-12)20-14(21-16)9-8-13-7-4-10-25-13/h1-10H,11H2,(H3,19,20,21,22,23)/b9-8+ |
| InChIKey | UONXOKVXFNTELD-CMDGGOBGSA-N |
| XLogP | 3.75 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |