C10H17N3O6 — CID 155902363
(5R,6R,7S,8R,8aS)-1-(2-aminoethyl)-6,7,8-trihydroxy-5-(hydroxymethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,2-a]pyridine-2,3-dione (PubChem CID 155902363) has the molecular formula C10H17N3O6 and a molecular weight of 275.26 g/mol. Its IUPAC name is (5R,6R,7S,8R,8aS)-1-(2-aminoethyl)-6,7,8-trihydroxy-5-(hydroxymethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,2-a]pyridine-2,3-dione.
| Compound Name | (5R,6R,7S,8R,8aS)-1-(2-aminoethyl)-6,7,8-trihydroxy-5-(hydroxymethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,2-a]pyridine-2,3-dione |
|---|---|
| PubChem CID | 155902363 |
| Molecular Formula | C10H17N3O6 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | (5R,6R,7S,8R,8aS)-1-(2-aminoethyl)-6,7,8-trihydroxy-5-(hydroxymethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,2-a]pyridine-2,3-dione |
| SMILES | NCCN1C(=O)C(=O)N2[C@H](CO)[C@@H](O)[C@H](O)[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C10H17N3O6/c11-1-2-12-8-7(17)6(16)5(15)4(3-14)13(8)10(19)9(12)18/h4-8,14-17H,1-3,11H2/t4-,5-,6+,7+,8+/m1/s1 |
| InChIKey | KBHIDJDULMFCEB-HEIBUPTGSA-N |
| XLogP | -4.60 |
| TPSA | 147.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|