C11H19N3O6 — CID 155902415
(5R,6R,7S,8R,8aS)-1-(3-aminopropyl)-6,7,8-trihydroxy-5-(hydroxymethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,2-a]pyridine-2,3-dione (PubChem CID 155902415) has the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. Its IUPAC name is (5R,6R,7S,8R,8aS)-1-(3-aminopropyl)-6,7,8-trihydroxy-5-(hydroxymethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,2-a]pyridine-2,3-dione.
| Compound Name | (5R,6R,7S,8R,8aS)-1-(3-aminopropyl)-6,7,8-trihydroxy-5-(hydroxymethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,2-a]pyridine-2,3-dione |
|---|---|
| PubChem CID | 155902415 |
| Molecular Formula | C11H19N3O6 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (5R,6R,7S,8R,8aS)-1-(3-aminopropyl)-6,7,8-trihydroxy-5-(hydroxymethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,2-a]pyridine-2,3-dione |
| SMILES | NCCCN1C(=O)C(=O)N2[C@H](CO)[C@@H](O)[C@H](O)[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C11H19N3O6/c12-2-1-3-13-9-8(18)7(17)6(16)5(4-15)14(9)11(20)10(13)19/h5-9,15-18H,1-4,12H2/t5-,6-,7+,8+,9+/m1/s1 |
| InChIKey | ZBLUWPMAVXXBPX-DFTQBPQZSA-N |
| XLogP | -4.21 |
| TPSA | 147.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|