C18H27N5O2 — CID 155902797
(3aR,5R,7aR)-1-pyrimidin-2-yl-N-(2-pyrrolidin-1-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide (PubChem CID 155902797) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is (3aR,5R,7aR)-1-pyrimidin-2-yl-N-(2-pyrrolidin-1-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aR,5R,7aR)-1-pyrimidin-2-yl-N-(2-pyrrolidin-1-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 155902797 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | (3aR,5R,7aR)-1-pyrimidin-2-yl-N-(2-pyrrolidin-1-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
| SMILES | O=C(NCCN1CCCC1)[C@H]1CC[C@@H]2[C@@H](CCN2c2ncccn2)O1 |
| InChI | InChI=1S/C18H27N5O2/c24-17(19-9-13-22-10-1-2-11-22)16-5-4-14-15(25-16)6-12-23(14)18-20-7-3-8-21-18/h3,7-8,14-16H,1-2,4-6,9-13H2,(H,19,24)/t14-,15-,16-/m1/s1 |
| InChIKey | GXAYNZRYGZFSGW-BZUAXINKSA-N |
| XLogP | 0.81 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |